![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 23in13/ | 2014-08-17 19:41 | - | |
| 2016/ | 2016-11-22 21:01 | - | |
| 2017/ | 2018-01-14 16:03 | - | |
| 2018/ | 2018-12-27 14:49 | - | |
| 2019/ | 2019-11-04 10:22 | - | |
| 2020/ | 2020-12-04 22:14 | - | |
| 2021/ | 2021-12-16 17:59 | - | |
| 2022/ | 2023-01-16 20:28 | - | |
| 2023/ | 2023-12-10 10:33 | - | |
| 2024/ | 2024-09-14 11:35 | - | |
| A Secret.mp3 | 2015-09-13 01:48 | 4.7M | |
| Album/ | 2014-11-20 11:22 | - | |
| Ambience.mp3 | 2015-12-10 22:22 | 4.6M | |
| Beowulf/ | 2013-12-15 23:45 | - | |
| Canyon.FAST.mp3 | 2014-10-21 19:23 | 100K | |
| Canyon.RECONSTITUTED.mp3 | 2014-10-22 20:24 | 2.8M | |
| Carbonobrac/ | 2018-04-23 19:22 | - | |
| Central Battery Business Card.pdf | 2011-10-29 19:10 | 258K | |
| City_Theme.mp3 | 2011-10-19 21:41 | 2.5M | |
| Delusion and Illusion 2012.mp3 | 2012-12-31 08:52 | 5.0M | |
| Denoument.mp3 | 2015-10-24 17:36 | 4.2M | |
| Evil_City_Theme.mp3 | 2011-10-19 21:40 | 3.2M | |
| Final_Cut_Big_Band.mp3 | 2011-10-19 21:25 | 1.1M | |
| Final_Cut_Chiptune.mp3 | 2011-10-19 21:26 | 1.0M | |
| Final_Cut_Epic.mp3 | 2011-10-15 17:12 | 1.1M | |
| Final_Cut_Original.mp3 | 2011-10-19 22:05 | 1.4M | |
| Georgie and Mr Kibbles.mp3 | 2011-11-30 19:59 | 4.0M | |
| Ghostbusters/ | 2016-07-05 21:26 | - | |
| Gypsy_Waltz.mp3 | 2011-10-19 21:41 | 3.0M | |
| Jasper_Rude/ | 2017-03-04 00:09 | - | |
| Luggage_Emergency .mp3 | 2014-11-16 21:08 | 5.2M | |
| Mixtape/ | 2017-03-04 23:04 | - | |
| Numbers/ | 2024-03-07 19:36 | - | |
| Phoenix_Quest.mp3 | 2011-11-01 00:20 | 6.0M | |
| Poison.mp3 | 2015-09-19 13:44 | 5.2M | |
| Quincy/ | 2020-09-03 01:15 | - | |
| Saturday_Morning.mp3 | 2012-12-01 12:25 | 2.2M | |
| Sherrif_McMellonhead.mp3 | 2011-11-17 08:42 | 3.7M | |
| Shes_Running_Away_2012.mp3 | 2012-12-06 23:55 | 3.8M | |
| Soundfonts/ | 2020-04-03 12:10 | - | |
| SpacesBetween/ | 2021-03-02 09:41 | - | |
| SpoilerRoom/ | 2024-05-27 19:00 | - | |
| Structure.mp3 | 2015-08-16 01:25 | 4.4M | |
| TTOCP2.mp3 | 2015-05-04 00:54 | 9.0M | |
| TTOCP3.mp3 | 2015-05-06 00:46 | 5.2M | |
| The Tall Tale of Too Tall Timmy.mp3 | 2011-11-26 22:29 | 2.8M | |
| The Treasure Beneath the Sign.mp3 | 2011-11-28 23:41 | 2.9M | |
| The_Water_Bearer_v2.mp3 | 2011-11-10 23:15 | 8.6M | |
| Tower of Casio Power.mp3 | 2015-04-30 23:16 | 6.2M | |
| UDS/ | 2016-03-20 22:24 | - | |
| Waterharp 1.mp3 | 2015-02-23 18:43 | 3.1M | |
| What was I to do_2012.mp3 | 2013-12-05 07:45 | 4.6M | |
| Zodiac_Fantasy/ | 2021-03-02 13:20 | - | |
| accentric/ | 2014-12-16 11:28 | - | |
| coulton/ | 2013-01-20 16:36 | - | |
| googleplayer.swf | 2011-10-19 20:27 | 68K | |
| hell/ | 2013-09-12 16:53 | - | |
| jess/ | 2022-09-10 11:45 | - | |